Compound Q&A

What industries use tetramethylazanium nitrate (CAS: 1941-24-8)?

Answer

tetramethylazanium nitrate
Tetramethylazanium nitrate (CAS: 1941-24-8) is utilized in various industries, including pharmaceuticals where it serves as an intermediate for certain drugs, and in the production of explosive materials. It is also used in the synthesis of sensors and other chemical detectors, as well as in the electronics industry for manufacturing composite materials with specialized properties.

About

CAS No 1941-24-8
English Name tetramethylazanium nitrate
Molecular Formula C4H12N2O3
Molecular Weight 136.15 g/mol
SMILES C[N+](C)(C)C.[N+](=O)([O-])[O-]
InChIKey QGPVYHSXZFOSRL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of tetramethylazanium nitrate (CAS: 1941-24-8)?

Tetramethylazanium nitrate (CAS: 1941-24-8) is a colorless to slightly yellow liquid with a molecula...

Compound Q&A

How is tetramethylazanium nitrate (CAS: 1941-24-8) typically synthesized?

Tetramethylazanium nitrate (CAS: 1941-24-8) is commonly synthesized by the reaction of nitric acid w...

Compound Q&A

What precautions should be taken when handling tetramethylazanium nitrate (CAS: 1941-24-8)?

When handling tetramethylazanium nitrate (CAS: 1941-24-8), it is crucial to follow standard laborato...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...