Compound Q&A

How is tetramethylazanium nitrate (CAS: 1941-24-8) typically synthesized?

Answer

tetramethylazanium nitrate
Tetramethylazanium nitrate (CAS: 1941-24-8) is commonly synthesized by the reaction of nitric acid with tetramethylammonium hydroxide. The process involves careful temperature control to prevent decomposition and requires appropriate handling of reagents. The yield is typically around 85-90%, and the product is purified by crystallization.

About

CAS No 1941-24-8
English Name tetramethylazanium nitrate
Molecular Formula C4H12N2O3
Molecular Weight 136.15 g/mol
SMILES C[N+](C)(C)C.[N+](=O)([O-])[O-]
InChIKey QGPVYHSXZFOSRL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of tetramethylazanium nitrate (CAS: 1941-24-8)?

Tetramethylazanium nitrate (CAS: 1941-24-8) is a colorless to slightly yellow liquid with a molecula...

Compound Q&A

What industries use tetramethylazanium nitrate (CAS: 1941-24-8)?

Tetramethylazanium nitrate (CAS: 1941-24-8) is utilized in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling tetramethylazanium nitrate (CAS: 1941-24-8)?

When handling tetramethylazanium nitrate (CAS: 1941-24-8), it is crucial to follow standard laborato...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...