Compound Q&A

What precautions should be taken when handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

Answer

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
When handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be stored in a cool, dry place away from direct sunlight and heat sources. Laboratory handling should be conducted in a well-ventilated area or a fume hood due to its potential volatility. In case of a spill, it is advised to clean up the area using appropriate absorbent materials and consult the Safety Data Sheet (SDS) for further guidance.

About

CAS No 50593-92-5
English Name 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES CSC1=NC=C(C(=N1)C(=O)O)Br
InChIKey YJEWVVYJOJJLBP-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is a white crystalline solid with a molecular...

Compound Q&A

How is 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5) typically synthesized?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is typically synthesized through the brominat...

Compound Q&A

What industries use 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is used in a variety of industries. In the ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...