Compound Q&A

How is 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5) typically synthesized?

Answer

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is typically synthesized through the bromination of 2-(methylthio)-4-pyrimidinecarboxylic acid. This process often involves the use of bromine in an appropriate solvent, such as acetic anhydride, under anhydrous conditions. The reaction is highly selective and yields the desired product with good efficiency. Post-synthesis purification is usually achieved by recrystallization from an appropriate solvent.

About

CAS No 50593-92-5
English Name 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES CSC1=NC=C(C(=N1)C(=O)O)Br
InChIKey YJEWVVYJOJJLBP-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is a white crystalline solid with a molecular...

Compound Q&A

What industries use 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is used in a variety of industries. In the ph...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

When handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...