Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

Answer

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is a white crystalline solid with a molecular weight of approximately 234.04 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. This compound is known for its low reactivity in aqueous solutions but can be quite reactive in organic solvents. It displays significant stability under normal storage conditions but requires careful handling to prevent unwanted side reactions.

About

CAS No 50593-92-5
English Name 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES CSC1=NC=C(C(=N1)C(=O)O)Br
InChIKey YJEWVVYJOJJLBP-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5) typically synthesized?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is typically synthesized through the brominat...

Compound Q&A

What industries use 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is used in a variety of industries. In the ph...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

When handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...