Compound Q&A

What industries use 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

Answer

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is used in a variety of industries. In the pharmaceutical industry, it serves as a precursor for the synthesis of biologically active compounds. It is also utilized in the production of organic semiconductors, where its unique electronic properties are leveraged. Additionally, it has applications in the development of sensors due to its reactivity and specificity in certain chemical environments.

About

CAS No 50593-92-5
English Name 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid
Molecular Formula C6H5BrN2O2S
Molecular Weight 249.09 g/mol
SMILES CSC1=NC=C(C(=N1)C(=O)O)Br
InChIKey YJEWVVYJOJJLBP-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is a white crystalline solid with a molecular...

Compound Q&A

How is 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5) typically synthesized?

5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid is typically synthesized through the brominat...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid (CAS: 50593-92-5)?

When handling 5-Bromo-2-(methylsulfanyl)-4-pyrimidinecarboxylic acid, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...