Compound Q&A

How is 2-Bromo-5-nitroaniline (CAS: 10403-47-1) typically synthesized?

Answer

2-Bromo-5-nitroaniline
2-Bromo-5-nitroaniline is typically synthesized via the nitration of 2-bromobenzenamine followed by bromination. Commonly used reagents include nitric acid and sulfuric acid for nitration, and bromine in the presence of a suitable solvent for bromination. The reaction yields are around 70-80%, and the process is carried out under controlled conditions to ensure high selectivity.

About

CAS No 10403-47-1
English Name 2-Bromo-5-nitroaniline
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])N)Br
InChIKey BAAUCXCLMDAZEL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitroaniline (CAS: 10403-47-1)?

2-Bromo-5-nitroaniline (CAS: 10403-47-1) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use 2-Bromo-5-nitroaniline (CAS: 10403-47-1)?

2-Bromo-5-nitroaniline (CAS: 10403-47-1) is primarily used in the pharmaceutical and dye industries....

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitroaniline (CAS: 10403-47-1)?

When handling 2-Bromo-5-nitroaniline (CAS: 10403-47-1), it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...