Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitroaniline (CAS: 10403-47-1)?

Answer

2-Bromo-5-nitroaniline
2-Bromo-5-nitroaniline (CAS: 10403-47-1) is a crystalline solid with a molecular weight of approximately 216.03 g/mol. It has a high solubility in organic solvents like ethanol and acetone. The compound is known for its strong reactivity, particularly with reducing agents, and exhibits moderate acidity due to the presence of the nitro group.

About

CAS No 10403-47-1
English Name 2-Bromo-5-nitroaniline
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])N)Br
InChIKey BAAUCXCLMDAZEL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 2-Bromo-5-nitroaniline (CAS: 10403-47-1) typically synthesized?

2-Bromo-5-nitroaniline is typically synthesized via the nitration of 2-bromobenzenamine followed by ...

Compound Q&A

What industries use 2-Bromo-5-nitroaniline (CAS: 10403-47-1)?

2-Bromo-5-nitroaniline (CAS: 10403-47-1) is primarily used in the pharmaceutical and dye industries....

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitroaniline (CAS: 10403-47-1)?

When handling 2-Bromo-5-nitroaniline (CAS: 10403-47-1), it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...