Compound Q&A

What industries use Ganciclovir sodium (CAS: 107910-75-8)?

Answer

Ganciclovir sodium
Ganciclovir sodium is primarily used in the pharmaceutical industry for the treatment of viral infections, particularly cytomegalovirus (CMV) in immunocompromised patients such as those with AIDS or organ transplant recipients. Although it has limited applications in other industries, it is also used in some research and diagnostic applications due to its antiviral properties.

About

English Name Ganciclovir sodium
Molecular Formula C9H12N5NaO4
Molecular Weight 277.21 g/mol
SMILES C1=NC2=C(N1COC(CO)CO)N=C(N=C2[O-])N.[Na+]
InChIKey JJICLMJFIKGAAU-UHFFFAOYSA-M
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganciclovir sodium (CAS: 107910-75-8)?

Ganciclovir sodium is a white to off-white crystalline powder with a molecular weight of approximate...

Compound Q&A

How is Ganciclovir sodium (CAS: 107910-75-8) typically synthesized?

Ganciclovir sodium is synthesized through a multi-step process involving the condensation of 2'-deox...

Compound Q&A

What precautions should be taken when handling Ganciclovir sodium (CAS: 107910-75-8)?

When handling Ganciclovir sodium (CAS: 107910-75-8), it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...