Compound Q&A

What are the physical and chemical properties of Ganciclovir sodium (CAS: 107910-75-8)?

Answer

Ganciclovir sodium
Ganciclovir sodium is a white to off-white crystalline powder with a molecular weight of approximately 404.46 g/mol. It is slightly soluble in water and ethanol. Ganciclovir sodium is relatively stable under normal conditions, but it can react with strong acids or bases to form inorganic salts. It has a specific melting point around 195-200°C and a pKa of approximately 3.6. The compound is generally stable at room temperature, but it should be stored in a cool, dry place away from direct sunlight.

About

English Name Ganciclovir sodium
Molecular Formula C9H12N5NaO4
Molecular Weight 277.21 g/mol
SMILES C1=NC2=C(N1COC(CO)CO)N=C(N=C2[O-])N.[Na+]
InChIKey JJICLMJFIKGAAU-UHFFFAOYSA-M
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Ganciclovir sodium (CAS: 107910-75-8) typically synthesized?

Ganciclovir sodium is synthesized through a multi-step process involving the condensation of 2'-deox...

Compound Q&A

What industries use Ganciclovir sodium (CAS: 107910-75-8)?

Ganciclovir sodium is primarily used in the pharmaceutical industry for the treatment of viral infec...

Compound Q&A

What precautions should be taken when handling Ganciclovir sodium (CAS: 107910-75-8)?

When handling Ganciclovir sodium (CAS: 107910-75-8), it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...