Compound Q&A

How is Ganciclovir sodium (CAS: 107910-75-8) typically synthesized?

Answer

Ganciclovir sodium
Ganciclovir sodium is synthesized through a multi-step process involving the condensation of 2'-deoxyuridine-5′-monophosphate with acyclovir. The reaction typically uses sodium hydride as a base, and the subsequent steps involve various hydrolysis, esterification, and alkylation reactions. The overall yield is around 50-60%, with the final step involving sodium hydroxide to form the sodium salt. The reaction conditions and purification steps are critical for achieving the desired selectivity and purity.

About

English Name Ganciclovir sodium
Molecular Formula C9H12N5NaO4
Molecular Weight 277.21 g/mol
SMILES C1=NC2=C(N1COC(CO)CO)N=C(N=C2[O-])N.[Na+]
InChIKey JJICLMJFIKGAAU-UHFFFAOYSA-M
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganciclovir sodium (CAS: 107910-75-8)?

Ganciclovir sodium is a white to off-white crystalline powder with a molecular weight of approximate...

Compound Q&A

What industries use Ganciclovir sodium (CAS: 107910-75-8)?

Ganciclovir sodium is primarily used in the pharmaceutical industry for the treatment of viral infec...

Compound Q&A

What precautions should be taken when handling Ganciclovir sodium (CAS: 107910-75-8)?

When handling Ganciclovir sodium (CAS: 107910-75-8), it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...