Compound Q&A

What precautions should be taken when handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

Answer

[3,5-Bis(trifluoromethyl)phenyl]acetic acid
When handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood due to its volatility and reactivity. Spills should be handled carefully using appropriate spill kits, and the material safety data sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 85068-33-3
English Name [3,5-Bis(trifluoromethyl)phenyl]acetic acid
Molecular Formula C10H6F6O2
Molecular Weight 272.14 g/mol
SMILES OC(=O)Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F
InChIKey PAWSKKHEEYTXSA-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is a highly reactive compound with a c...

Compound Q&A

How is [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) typically synthesized?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) can be synthesized by the acetylation ...

Compound Q&A

What industries use [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is used in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...