Compound Q&A

How is [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) typically synthesized?

Answer

[3,5-Bis(trifluoromethyl)phenyl]acetic acid
[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) can be synthesized by the acetylation of 3,5-bis(trifluoromethyl)phenol using acetic anhydride in the presence of a catalyst like pyridine. The reaction is typically carried out under mild conditions to achieve high yield and selectivity. This compound is also synthesized by the oxidation of 3,5-bis(trifluoromethyl)toluene with sodium hypochlorite.

About

CAS No 85068-33-3
English Name [3,5-Bis(trifluoromethyl)phenyl]acetic acid
Molecular Formula C10H6F6O2
Molecular Weight 272.14 g/mol
SMILES OC(=O)Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F
InChIKey PAWSKKHEEYTXSA-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is a highly reactive compound with a c...

Compound Q&A

What industries use [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

When handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...