Compound Q&A

What are the physical and chemical properties of [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

Answer

[3,5-Bis(trifluoromethyl)phenyl]acetic acid
[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is a highly reactive compound with a crystalline form. It has a molecular weight of approximately 354.15 g/mol. The compound is slightly soluble in water but soluble in organic solvents like ethanol and acetone. It exhibits strong acidity and can undergo various reactions such as esterification and nucleophilic substitution.

About

CAS No 85068-33-3
English Name [3,5-Bis(trifluoromethyl)phenyl]acetic acid
Molecular Formula C10H6F6O2
Molecular Weight 272.14 g/mol
SMILES OC(=O)Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F
InChIKey PAWSKKHEEYTXSA-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) typically synthesized?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) can be synthesized by the acetylation ...

Compound Q&A

What industries use [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

When handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...