Compound Q&A

What industries use [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

Answer

[3,5-Bis(trifluoromethyl)phenyl]acetic acid
[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for enhancing properties of polymers, and in the electronics industry for the production of sensors and semiconductors. It is also utilized in the preparation of various organic compounds for research and development.

About

CAS No 85068-33-3
English Name [3,5-Bis(trifluoromethyl)phenyl]acetic acid
Molecular Formula C10H6F6O2
Molecular Weight 272.14 g/mol
SMILES OC(=O)Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F
InChIKey PAWSKKHEEYTXSA-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) is a highly reactive compound with a c...

Compound Q&A

How is [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) typically synthesized?

[3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3) can be synthesized by the acetylation ...

Compound Q&A

What precautions should be taken when handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3)?

When handling [3,5-Bis(trifluoromethyl)phenyl]acetic acid (CAS: 85068-33-3), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...