Compound Q&A

What precautions should be taken when handling 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

Answer

4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
When handling 4-Amino-3-phenylbutanoic acid hydrochloride, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Handle in a well-ventilated area or under a fume hood due to potential respiratory irritation. In case of spill, avoid direct contact and clean up using appropriate absorbents. Always refer to the safety data sheet (SDS) for more detailed information on safe handling and storage.

About

CAS No 3060-41-1
English Name 4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
Molecular Formula C10H14ClNO2
Molecular Weight 215.68 g/mol
SMILES C1=CC=C(C=C1)C(CC(=O)O)CN.Cl
InChIKey XSYRYMGYPBGOPS-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

4-Amino-3-phenylbutanoic acid hydrochloride is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1) typically synthesized?

4-Amino-3-phenylbutanoic acid hydrochloride is usually synthesized via a multi-step process starting...

Compound Q&A

What industries use 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

4-Amino-3-phenylbutanoic acid hydrochloride is primarily used in the pharmaceutical industry for the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...