Compound Q&A

What are the physical and chemical properties of 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

Answer

4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
4-Amino-3-phenylbutanoic acid hydrochloride is a crystalline solid with a molecular weight of approximately 269.76 g/mol and a melting point of 145-147°C. It is slightly soluble in water and more soluble in organic solvents. It is relatively stable under normal conditions but can react with bases to form the corresponding amine compound. This compound is often used in the pharmaceutical and chemical industry due to its reactivity and specific functional groups.

About

CAS No 3060-41-1
English Name 4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
Molecular Formula C10H14ClNO2
Molecular Weight 215.68 g/mol
SMILES C1=CC=C(C=C1)C(CC(=O)O)CN.Cl
InChIKey XSYRYMGYPBGOPS-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1) typically synthesized?

4-Amino-3-phenylbutanoic acid hydrochloride is usually synthesized via a multi-step process starting...

Compound Q&A

What industries use 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

4-Amino-3-phenylbutanoic acid hydrochloride is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

When handling 4-Amino-3-phenylbutanoic acid hydrochloride, it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...