Compound Q&A

What industries use 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

Answer

4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
4-Amino-3-phenylbutanoic acid hydrochloride is primarily used in the pharmaceutical industry for the synthesis of bioactive compounds and drug intermediates. It also finds applications in the chemical industry for the development of new materials, such as sensors and semiconductors. Additionally, it is utilized in the polymer industry for the preparation of functional polymers with improved properties.

About

CAS No 3060-41-1
English Name 4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
Molecular Formula C10H14ClNO2
Molecular Weight 215.68 g/mol
SMILES C1=CC=C(C=C1)C(CC(=O)O)CN.Cl
InChIKey XSYRYMGYPBGOPS-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

4-Amino-3-phenylbutanoic acid hydrochloride is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1) typically synthesized?

4-Amino-3-phenylbutanoic acid hydrochloride is usually synthesized via a multi-step process starting...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

When handling 4-Amino-3-phenylbutanoic acid hydrochloride, it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...