Compound Q&A

How is 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1) typically synthesized?

Answer

4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
4-Amino-3-phenylbutanoic acid hydrochloride is usually synthesized via a multi-step process starting with 3-phenylbutyric acid and amino group introduction. Common methods include Grignard reagent addition followed by hydrolysis and acidification. The final step involves neutralization with hydrochloric acid to form the hydrochloride salt. This process is carried out under anhydrous conditions to ensure product purity and yield, typically around 90-95%.

About

CAS No 3060-41-1
English Name 4-Amino-3-phenylbutanoic acid hydrochloride (1:1)
Molecular Formula C10H14ClNO2
Molecular Weight 215.68 g/mol
SMILES C1=CC=C(C=C1)C(CC(=O)O)CN.Cl
InChIKey XSYRYMGYPBGOPS-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

4-Amino-3-phenylbutanoic acid hydrochloride is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

4-Amino-3-phenylbutanoic acid hydrochloride is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-phenylbutanoic acid hydrochloride (CAS: 3060-41-1)?

When handling 4-Amino-3-phenylbutanoic acid hydrochloride, it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...