Compound Q&A

How is Cidofovir Dihydrate (CAS: 149394-66-1) typically synthesized?

Answer

Cidofovir Dihydrate
Cidofovir dihydrate is typically synthesized through a multistep process involving the condensation of 2'-deoxyguanosine with 2-hydroxy-5-nitroimidazole-1-ylidene, followed by reduction and hydration. The synthesis involves the use of reagents such as sodium hydride and acetic anhydride. The yield is moderate, around 50-60%, and the reaction conditions are optimized for selectivity and purity.

About

English Name Cidofovir Dihydrate
Molecular Formula C8H18N3O8P
Molecular Weight 315.22 g/mol
EINECS 814-987-8
SMILES C1=CN(C(=O)N=C1N)CC(CO)OCP(=O)(O)O.O.O
InChIKey FPKARFMSZDBYQF-ILKKLZGPSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cidofovir Dihydrate (CAS: 149394-66-1)?

Cidofovir dihydrate is a white crystalline solid with a molecular weight of approximately 597.62 g/m...

Compound Q&A

What industries use Cidofovir Dihydrate (CAS: 149394-66-1)?

Cidofovir dihydrate is primarily used in the pharmaceutical industry for the treatment of viral infe...

Compound Q&A

What precautions should be taken when handling Cidofovir Dihydrate (CAS: 149394-66-1)?

When handling Cidofovir dihydrate, it is important to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...