Compound Q&A

What are the physical and chemical properties of Cidofovir Dihydrate (CAS: 149394-66-1)?

Answer

Cidofovir Dihydrate
Cidofovir dihydrate is a white crystalline solid with a molecular weight of approximately 597.62 g/mol. It has a high solubility in water and is poorly soluble in organic solvents. Chemically, it is a nucleoside analog with antiviral activity. It is reactive towards nucleophilic attack and can form stable complexes with metal ions, making it useful in various pharmaceutical applications.

About

English Name Cidofovir Dihydrate
Molecular Formula C8H18N3O8P
Molecular Weight 315.22 g/mol
EINECS 814-987-8
SMILES C1=CN(C(=O)N=C1N)CC(CO)OCP(=O)(O)O.O.O
InChIKey FPKARFMSZDBYQF-ILKKLZGPSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Cidofovir Dihydrate (CAS: 149394-66-1) typically synthesized?

Cidofovir dihydrate is typically synthesized through a multistep process involving the condensation ...

Compound Q&A

What industries use Cidofovir Dihydrate (CAS: 149394-66-1)?

Cidofovir dihydrate is primarily used in the pharmaceutical industry for the treatment of viral infe...

Compound Q&A

What precautions should be taken when handling Cidofovir Dihydrate (CAS: 149394-66-1)?

When handling Cidofovir dihydrate, it is important to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...