Compound Q&A

What precautions should be taken when handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

Answer

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
When handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. This compound should be stored in a fume hood and away from heat and sources of ignition. In case of a spill, it should be carefully cleaned up using appropriate absorbents, and the area should be ventilated. The material safety data sheet (MSDS) should be consulted for detailed handling and disposal guidelines.

About

English Name 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
Molecular Formula C12H10F6O2
Molecular Weight 300.2 g/mol
SMILES CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O
InChIKey ORLKRFYFNMCQIG-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is a crystalline solid with a molecular we...

Compound Q&A

How is 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0) typically synthesized?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is typically synthesized through a multi-s...

Compound Q&A

What industries use 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is used in the pharmaceutical industry for...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...