Compound Q&A

How is 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0) typically synthesized?

Answer

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is typically synthesized through a multi-step process involving the alkylation of a trifluoromethylated aromatic compound followed by esterification. Palladium-catalyzed coupling reactions and acid catalysis are commonly used. The yield is around 70-80%, and the reaction is selective due to the steric hindrance and electronic properties of the trifluoromethyl group.

About

English Name 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
Molecular Formula C12H10F6O2
Molecular Weight 300.2 g/mol
SMILES CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O
InChIKey ORLKRFYFNMCQIG-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is a crystalline solid with a molecular we...

Compound Q&A

What industries use 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

When handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...