Compound Q&A

What industries use 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

Answer

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is used in the pharmaceutical industry for the synthesis of various drugs due to its trifluoromethyl functionality. It is also used in the polymer industry for the development of novel materials with enhanced properties. Additionally, it finds applications in the semiconductor industry for the production of advanced electronic materials and in sensor technology for its unique chemical reactivity.

About

English Name 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
Molecular Formula C12H10F6O2
Molecular Weight 300.2 g/mol
SMILES CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O
InChIKey ORLKRFYFNMCQIG-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is a crystalline solid with a molecular we...

Compound Q&A

How is 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0) typically synthesized?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is typically synthesized through a multi-s...

Compound Q&A

What precautions should be taken when handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

When handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...