Compound Q&A

What are the physical and chemical properties of 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

Answer

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is a crystalline solid with a molecular weight of approximately 390.11 g/mol. It has low water solubility and moderate solubility in organic solvents like dichloromethane. This compound is highly reactive due to the presence of trifluoromethyl groups, which enhance its polarity. It is stable under normal conditions but should be stored away from strong bases and reducing agents.

About

English Name 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid
Molecular Formula C12H10F6O2
Molecular Weight 300.2 g/mol
SMILES CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O
InChIKey ORLKRFYFNMCQIG-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0) typically synthesized?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is typically synthesized through a multi-s...

Compound Q&A

What industries use 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid (CAS: 289686-70-0)?

When handling 2-(3,5-Bis(trifluoromethyl)phenyl)-2-methylpropanoic acid, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...