Compound Q&A

What industries use 2-Fluoro-4-nitroaniline (CAS: 369-35-7)?

Answer

2-Fluoro-4-nitroaniline
2-Fluoro-4-nitroaniline finds applications primarily in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients (APIs). It is also used in the production of dyes and pigments, as a precursor for the synthesis of other functional materials, and in sensor technology for detecting specific chemicals.

About

CAS No 369-35-7
English Name 2-Fluoro-4-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])F)N
InChIKey LETNCFZQCNCACQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-nitroaniline (CAS: 369-35-7)?

2-Fluoro-4-nitroaniline is a crystalline compound with a molecular weight of approximately 177.04 g/...

Compound Q&A

How is 2-Fluoro-4-nitroaniline (CAS: 369-35-7) typically synthesized?

2-Fluoro-4-nitroaniline is typically synthesized by the nitration of 2-fluorobenzenesulfonamide. The...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-nitroaniline (CAS: 369-35-7)?

When handling 2-Fluoro-4-nitroaniline, it is crucial to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...