Compound Q&A

How is 2-Fluoro-4-nitroaniline (CAS: 369-35-7) typically synthesized?

Answer

2-Fluoro-4-nitroaniline
2-Fluoro-4-nitroaniline is typically synthesized by the nitration of 2-fluorobenzenesulfonamide. The process involves the use of a nitrating agent such as nitric acid and sulfuric acid mixture. The reaction is carried out under controlled conditions to ensure high selectivity and yield. Commonly, the product is purified using recrystallization or distillation techniques.

About

CAS No 369-35-7
English Name 2-Fluoro-4-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])F)N
InChIKey LETNCFZQCNCACQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-nitroaniline (CAS: 369-35-7)?

2-Fluoro-4-nitroaniline is a crystalline compound with a molecular weight of approximately 177.04 g/...

Compound Q&A

What industries use 2-Fluoro-4-nitroaniline (CAS: 369-35-7)?

2-Fluoro-4-nitroaniline finds applications primarily in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-nitroaniline (CAS: 369-35-7)?

When handling 2-Fluoro-4-nitroaniline, it is crucial to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...