Compound Q&A

What precautions should be taken when handling Micafungin sodium (CAS: 208538-73-2)?

Answer

Micafungin sodium
When handling Micafungin sodium, it is recommended to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store the compound in a cool, dry place away from direct sunlight and heat sources. Spills should be cleaned up with appropriate absorbent materials, and the area should be ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name Micafungin sodium
Molecular Formula C56H70N9NaO23S
Molecular Weight 1168.22 g/mol
SMILES CCCCCOc1ccc(cc1)c1onc(c1)c1ccc(cc1)C(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@H]2N(C[CH]NC(=O)[C@@H](NC(=O)[C@H]3N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[C@@H](C3)O)[C@@H]([C@H](c1ccc(c(c1)OS(=O)(=O)O)O)O)O)C[C@@H]([C@@H]2O)C
InChIKey KOOAFHGJVIVFMZ-WZPXRXMFSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Micafungin sodium (CAS: 208538-73-2)?

Micafungin sodium is a white to off-white crystalline powder with a molecular weight of approximatel...

Compound Q&A

How is Micafungin sodium (CAS: 208538-73-2) typically synthesized?

Micafungin sodium is synthesized through a multi-step process involving the condensation of a sugar ...

Compound Q&A

What industries use Micafungin sodium (CAS: 208538-73-2)?

Micafungin sodium is primarily used in the pharmaceutical industry, where it serves as an antifungal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...