Compound Q&A

What are the physical and chemical properties of Micafungin sodium (CAS: 208538-73-2)?

Answer

Micafungin sodium
Micafungin sodium is a white to off-white crystalline powder with a molecular weight of approximately 713.79 g/mol. It is sparingly soluble in water and has good solubility in ethanol. Micafungin sodium exhibits low reactivity under normal conditions, making it stable in various pH ranges. It is used in pharmaceutical applications and has a high degree of chemical stability.

About

English Name Micafungin sodium
Molecular Formula C56H70N9NaO23S
Molecular Weight 1168.22 g/mol
SMILES CCCCCOc1ccc(cc1)c1onc(c1)c1ccc(cc1)C(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@H]2N(C[CH]NC(=O)[C@@H](NC(=O)[C@H]3N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[C@@H](C3)O)[C@@H]([C@H](c1ccc(c(c1)OS(=O)(=O)O)O)O)O)C[C@@H]([C@@H]2O)C
InChIKey KOOAFHGJVIVFMZ-WZPXRXMFSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Micafungin sodium (CAS: 208538-73-2) typically synthesized?

Micafungin sodium is synthesized through a multi-step process involving the condensation of a sugar ...

Compound Q&A

What industries use Micafungin sodium (CAS: 208538-73-2)?

Micafungin sodium is primarily used in the pharmaceutical industry, where it serves as an antifungal...

Compound Q&A

What precautions should be taken when handling Micafungin sodium (CAS: 208538-73-2)?

When handling Micafungin sodium, it is recommended to use personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...