Compound Q&A

What industries use Micafungin sodium (CAS: 208538-73-2)?

Answer

Micafungin sodium
Micafungin sodium is primarily used in the pharmaceutical industry, where it serves as an antifungal agent. It is also used in the development of diagnostic tools and sensors due to its chemical properties, although on a smaller scale compared to its pharmaceutical applications.

About

English Name Micafungin sodium
Molecular Formula C56H70N9NaO23S
Molecular Weight 1168.22 g/mol
SMILES CCCCCOc1ccc(cc1)c1onc(c1)c1ccc(cc1)C(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@H]2N(C[CH]NC(=O)[C@@H](NC(=O)[C@H]3N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[C@@H](C3)O)[C@@H]([C@H](c1ccc(c(c1)OS(=O)(=O)O)O)O)O)C[C@@H]([C@@H]2O)C
InChIKey KOOAFHGJVIVFMZ-WZPXRXMFSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Micafungin sodium (CAS: 208538-73-2)?

Micafungin sodium is a white to off-white crystalline powder with a molecular weight of approximatel...

Compound Q&A

How is Micafungin sodium (CAS: 208538-73-2) typically synthesized?

Micafungin sodium is synthesized through a multi-step process involving the condensation of a sugar ...

Compound Q&A

What precautions should be taken when handling Micafungin sodium (CAS: 208538-73-2)?

When handling Micafungin sodium, it is recommended to use personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...