Compound Q&A

How is Micafungin sodium (CAS: 208538-73-2) typically synthesized?

Answer

Micafungin sodium
Micafungin sodium is synthesized through a multi-step process involving the condensation of a sugar derivative with an acetylenic alcohol. The reaction typically involves the use of a palladium catalyst to achieve high selectivity and yield. The final product is then neutralized to form the sodium salt.

About

English Name Micafungin sodium
Molecular Formula C56H70N9NaO23S
Molecular Weight 1168.22 g/mol
SMILES CCCCCOc1ccc(cc1)c1onc(c1)c1ccc(cc1)C(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@H]2N(C[CH]NC(=O)[C@@H](NC(=O)[C@H]3N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[C@@H](C3)O)[C@@H]([C@H](c1ccc(c(c1)OS(=O)(=O)O)O)O)O)C[C@@H]([C@@H]2O)C
InChIKey KOOAFHGJVIVFMZ-WZPXRXMFSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Micafungin sodium (CAS: 208538-73-2)?

Micafungin sodium is a white to off-white crystalline powder with a molecular weight of approximatel...

Compound Q&A

What industries use Micafungin sodium (CAS: 208538-73-2)?

Micafungin sodium is primarily used in the pharmaceutical industry, where it serves as an antifungal...

Compound Q&A

What precautions should be taken when handling Micafungin sodium (CAS: 208538-73-2)?

When handling Micafungin sodium, it is recommended to use personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...