Compound Q&A

What industries use 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

Answer

3-(3-Chlorophenyl)acrylic acid
3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) finds applications in pharmaceuticals, where it serves as an intermediate in the synthesis of drug molecules. It is also used in the production of polymers, sensors, and semiconductors due to its functional groups that enhance material properties. Its reactivity and versatility make it a valuable compound in these industries.

About

CAS No 1866-38-2
English Name 3-(3-Chlorophenyl)acrylic acid
Molecular Formula C9H7ClO2
Molecular Weight 182.61 g/mol
SMILES C1=CC(=CC(=C1)Cl)C=CC(=O)O
InChIKey FFKGOJWPSXRALK-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) typically synthesized?

3-(3-Chlorophenyl)acrylic acid is commonly synthesized via the chlorination of 3-phenylacrylic acid ...

Compound Q&A

What precautions should be taken when handling 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

When handling 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2), it is essential to wear personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...