Compound Q&A

What are the physical and chemical properties of 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

Answer

3-(3-Chlorophenyl)acrylic acid
3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) is a crystalline solid with a molecular weight of approximately 183.65 g/mol. It has a pKa of around 3.5 and is slightly soluble in water. The compound is reactive and can undergo polymerization and condensation reactions under certain conditions. It is typically used in organic synthesis and as a precursor in various chemical processes.

About

CAS No 1866-38-2
English Name 3-(3-Chlorophenyl)acrylic acid
Molecular Formula C9H7ClO2
Molecular Weight 182.61 g/mol
SMILES C1=CC(=CC(=C1)Cl)C=CC(=O)O
InChIKey FFKGOJWPSXRALK-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) typically synthesized?

3-(3-Chlorophenyl)acrylic acid is commonly synthesized via the chlorination of 3-phenylacrylic acid ...

Compound Q&A

What industries use 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) finds applications in pharmaceuticals, where it serv...

Compound Q&A

What precautions should be taken when handling 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

When handling 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2), it is essential to wear personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...