Compound Q&A

How is 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) typically synthesized?

Answer

3-(3-Chlorophenyl)acrylic acid
3-(3-Chlorophenyl)acrylic acid is commonly synthesized via the chlorination of 3-phenylacrylic acid followed by acetylation. This process involves the use of chlorine gas and acetyl chloride as reagents. The yield can be up to 85%, and the reaction is typically catalyzed by strong acids like sulfuric acid. High selectivity and purity can be achieved using appropriate techniques.

About

CAS No 1866-38-2
English Name 3-(3-Chlorophenyl)acrylic acid
Molecular Formula C9H7ClO2
Molecular Weight 182.61 g/mol
SMILES C1=CC(=CC(=C1)Cl)C=CC(=O)O
InChIKey FFKGOJWPSXRALK-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2) finds applications in pharmaceuticals, where it serv...

Compound Q&A

What precautions should be taken when handling 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2)?

When handling 3-(3-Chlorophenyl)acrylic acid (CAS: 1866-38-2), it is essential to wear personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...