Compound Q&A

What precautions should be taken when handling 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

Answer

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid
Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn when handling 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid. Work should be conducted in a fume hood to minimize exposure to vapors. In case of a spill, it should be carefully cleaned up using appropriate absorbent materials. Safety data sheets (SDS) should be consulted for detailed handling and emergency procedures. This compound is not particularly reactive, but care should be taken to avoid contact with strong bases.

About

CAS No 80194-68-9
English Name 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=C(C=NC(=C1Cl)C(=O)O)C(F)(F)F
InChIKey HXRMCZBDTDCCOP-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is a crystalline compound with a molecular we...

Compound Q&A

How is 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9) typically synthesized?

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized through a multi-step...

Compound Q&A

What industries use 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is primarily used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...