Compound Q&A

How is 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9) typically synthesized?

Answer

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid
3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized through a multi-step process involving the reaction of 2-chloro-5-(trifluoromethyl)pyridine with carbon dioxide in the presence of a suitable catalyst. This process yields a high yield and good selectivity. The synthesized compound can be purified by recrystallization from an appropriate solvent.

About

CAS No 80194-68-9
English Name 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=C(C=NC(=C1Cl)C(=O)O)C(F)(F)F
InChIKey HXRMCZBDTDCCOP-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is a crystalline compound with a molecular we...

Compound Q&A

What industries use 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...