Compound Q&A

What industries use 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

Answer

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid
3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is primarily used in the pharmaceutical industry for the synthesis of certain drug intermediates due to its unique chemical properties. It also finds applications in the polymer industry for the modification of polymers to enhance their mechanical and thermal properties. Additionally, it is used in the development of sensors and semiconductors, although on a smaller scale.

About

CAS No 80194-68-9
English Name 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=C(C=NC(=C1Cl)C(=O)O)C(F)(F)F
InChIKey HXRMCZBDTDCCOP-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is a crystalline compound with a molecular we...

Compound Q&A

How is 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9) typically synthesized?

3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized through a multi-step...

Compound Q&A

What precautions should be taken when handling 3-Chloro-5-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-68-9)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...