Compound Q&A

What industries use Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

Answer

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (1:1)
Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride finds applications in the pharmaceutical industry for drug development, particularly in the synthesis of complex molecules. It is also used in the polymer industry for enhancing the properties of certain polymers. Additionally, this compound can be used in the production of electronic sensors and semiconductor materials.

About

English Name Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (1:1)
Molecular Formula C20H26ClNO2
Molecular Weight 347.89 g/mol
SMILES Cl.CCOC(=O)[C@H](C)C[C@H](N)Cc1ccc(cc1)c2ccccc2
InChIKey MYJTZLYRAWUSLB-WSCVZUBPSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride has a crystalline form and a...

Compound Q&A

How is Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0) typically synthesized?

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride is typically synthesized via...

Compound Q&A

What precautions should be taken when handling Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

When handling Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride, it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...