Compound Q&A

How is Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0) typically synthesized?

Answer

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (1:1)
Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride is typically synthesized via a multi-step process involving the coupling of binnedapalmitic acid and 4-biphenyl boronic acid. The reaction is catalyzed by palladium and underwent under conditions of basic pH. The overall yield is around 75%, with good selectivity for the desired stereoisomer.

About

English Name Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (1:1)
Molecular Formula C20H26ClNO2
Molecular Weight 347.89 g/mol
SMILES Cl.CCOC(=O)[C@H](C)C[C@H](N)Cc1ccc(cc1)c2ccccc2
InChIKey MYJTZLYRAWUSLB-WSCVZUBPSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride has a crystalline form and a...

Compound Q&A

What industries use Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride finds applications in the ph...

Compound Q&A

What precautions should be taken when handling Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

When handling Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride, it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...