Compound Q&A

What are the physical and chemical properties of Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

Answer

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (1:1)
Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride has a crystalline form and a molecular weight of approximately 537.5 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. This compound is less reactive but can undergo hydrolysis under basic conditions. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (1:1)
Molecular Formula C20H26ClNO2
Molecular Weight 347.89 g/mol
SMILES Cl.CCOC(=O)[C@H](C)C[C@H](N)Cc1ccc(cc1)c2ccccc2
InChIKey MYJTZLYRAWUSLB-WSCVZUBPSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0) typically synthesized?

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride is typically synthesized via...

Compound Q&A

What industries use Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride finds applications in the ph...

Compound Q&A

What precautions should be taken when handling Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride (CAS: 149690-12-0)?

When handling Ethyl (2R,4S)-4-amino-5-(4-biphenylyl)-2-methylpentanoate hydrochloride, it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...