Compound Q&A

What industries use 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

Answer

2-Bromo-3,4-difluoronitrobenzene
2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is primarily used in the pharmaceutical and dye industries. It serves as a precursor in the synthesis of various drugs and pigments. Additionally, it finds applications in the production of sensors and semiconductors due to its unique electronic properties.

About

English Name 2-Bromo-3,4-difluoronitrobenzene
Molecular Formula C6H2BrF2NO2
Molecular Weight 237.99 g/mol
SMILES C1=CC(=C(C(=C1[N+](=O)[O-])Br)F)F
InChIKey OANBJAYTIQWYDQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is a solid with a crystalline form. Its molecula...

Compound Q&A

How is 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) typically synthesized?

2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is typically synthesized through the electrophil...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

When handling 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...