Compound Q&A

What are the physical and chemical properties of 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

Answer

2-Bromo-3,4-difluoronitrobenzene
2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is a solid with a crystalline form. Its molecular weight is approximately 260.02 g/mol. It has low water solubility, with a solubility of about 0.1 g/L at 20°C. The compound is known for its stability under normal conditions but shows moderate reactivity in the presence of strong reducing or oxidizing agents. It is soluble in common organic solvents such as dichloromethane and acetonitrile. This compound is used in the preparation of pharmaceuticals, dyes, and other specialty chemicals.

About

English Name 2-Bromo-3,4-difluoronitrobenzene
Molecular Formula C6H2BrF2NO2
Molecular Weight 237.99 g/mol
SMILES C1=CC(=C(C(=C1[N+](=O)[O-])Br)F)F
InChIKey OANBJAYTIQWYDQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) typically synthesized?

2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is typically synthesized through the electrophil...

Compound Q&A

What industries use 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is primarily used in the pharmaceutical and dye ...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

When handling 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...