Compound Q&A

How is 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) typically synthesized?

Answer

2-Bromo-3,4-difluoronitrobenzene
2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is typically synthesized through the electrophilic substitution of nitrobenzene with bromine and fluorine using silica gel as a catalyst at elevated temperatures. This process ensures high selectivity and good yield. The reaction involves the sequential introduction of bromine and fluorine atoms to the aromatic ring, followed by nitration to introduce the nitro group.

About

English Name 2-Bromo-3,4-difluoronitrobenzene
Molecular Formula C6H2BrF2NO2
Molecular Weight 237.99 g/mol
SMILES C1=CC(=C(C(=C1[N+](=O)[O-])Br)F)F
InChIKey OANBJAYTIQWYDQ-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is a solid with a crystalline form. Its molecula...

Compound Q&A

What industries use 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2) is primarily used in the pharmaceutical and dye ...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2)?

When handling 2-Bromo-3,4-difluoronitrobenzene (CAS: 350699-92-2), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...