Compound Q&A

What precautions should be taken when handling 5-Nitroquinoline (CAS: 607-34-1)?

Answer

5-Nitroquinoline
When handling 5-Nitroquinoline (CAS: 607-34-1), it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Work should be conducted in a well-ventilated area, preferably in a fume hood. Spills should be cleaned up immediately using appropriate materials, and the area should be thoroughly decontaminated. Always refer to the safety data sheet (SDS) for detailed information on handling and storage.

About

CAS No 607-34-1
English Name 5-Nitroquinoline
Molecular Formula C9H6N2O2
Molecular Weight 174.16 g/mol
SMILES C1=CC2=C(C=CC=N2)C(=C1)[N+](=O)[O-]
InChIKey NDDZXHOCOKCNBM-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitroquinoline (CAS: 607-34-1)?

5-Nitroquinoline (CAS: 607-34-1) has a crystalline form with a molecular weight of 179.07 g/mol. It ...

Compound Q&A

How is 5-Nitroquinoline (CAS: 607-34-1) typically synthesized?

5-Nitroquinoline (CAS: 607-34-1) is typically synthesized through the nitration of quinoline. This i...

Compound Q&A

What industries use 5-Nitroquinoline (CAS: 607-34-1)?

5-Nitroquinoline (CAS: 607-34-1) finds applications in pharmaceuticals, where it serves as a precurs...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...