Compound Q&A

What industries use 5-Nitroquinoline (CAS: 607-34-1)?

Answer

5-Nitroquinoline
5-Nitroquinoline (CAS: 607-34-1) finds applications in pharmaceuticals, where it serves as a precursor for drug synthesis. It is also used in the production of dyes and pigments. Additionally, it plays a role in the development of sensors and semiconductors due to its unique optical and electronic properties.

About

CAS No 607-34-1
English Name 5-Nitroquinoline
Molecular Formula C9H6N2O2
Molecular Weight 174.16 g/mol
SMILES C1=CC2=C(C=CC=N2)C(=C1)[N+](=O)[O-]
InChIKey NDDZXHOCOKCNBM-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitroquinoline (CAS: 607-34-1)?

5-Nitroquinoline (CAS: 607-34-1) has a crystalline form with a molecular weight of 179.07 g/mol. It ...

Compound Q&A

How is 5-Nitroquinoline (CAS: 607-34-1) typically synthesized?

5-Nitroquinoline (CAS: 607-34-1) is typically synthesized through the nitration of quinoline. This i...

Compound Q&A

What precautions should be taken when handling 5-Nitroquinoline (CAS: 607-34-1)?

When handling 5-Nitroquinoline (CAS: 607-34-1), it is crucial to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...