Compound Q&A

What are the physical and chemical properties of 5-Nitroquinoline (CAS: 607-34-1)?

Answer

5-Nitroquinoline
5-Nitroquinoline (CAS: 607-34-1) has a crystalline form with a molecular weight of 179.07 g/mol. It is slightly soluble in water but soluble in most organic solvents. Chemically, it is moderately reactive, particularly towards reducing agents and nucleophiles. It exhibits basic properties due to the presence of an imine group.

About

CAS No 607-34-1
English Name 5-Nitroquinoline
Molecular Formula C9H6N2O2
Molecular Weight 174.16 g/mol
SMILES C1=CC2=C(C=CC=N2)C(=C1)[N+](=O)[O-]
InChIKey NDDZXHOCOKCNBM-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 5-Nitroquinoline (CAS: 607-34-1) typically synthesized?

5-Nitroquinoline (CAS: 607-34-1) is typically synthesized through the nitration of quinoline. This i...

Compound Q&A

What industries use 5-Nitroquinoline (CAS: 607-34-1)?

5-Nitroquinoline (CAS: 607-34-1) finds applications in pharmaceuticals, where it serves as a precurs...

Compound Q&A

What precautions should be taken when handling 5-Nitroquinoline (CAS: 607-34-1)?

When handling 5-Nitroquinoline (CAS: 607-34-1), it is crucial to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...