Compound Q&A

How is N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9) typically synthesized?

Answer

N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (1:1)
N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride is typically synthesized via an acylation reaction of a phenoxyphenol with methanesulfonamide, followed by hydrochloric acid treatment to form the hydrochloride salt. This process involves the use of catalysts such as triethylamine and requires careful control of reaction temperature and time to achieve high yield and selectivity.

About

English Name N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (1:1)
Molecular Formula C16H19ClN2O5S
Molecular Weight 386.86 g/mol
SMILES COC1=CC(=C(C=C1C(=O)CN)OC2=CC=CC=C2)NS(=O)(=O)C.Cl
InChIKey NWUBXODWWYGUHS-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9)?

N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride is a white crystalline powder...

Compound Q&A

What industries use N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9)?

N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9)?

When handling N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride, it is crucial ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...