Compound Q&A

What are the physical and chemical properties of N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9)?

Answer

N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (1:1)
N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride is a white crystalline powder with a molecular weight of approximately 554.74 g/mol. It has good solubility in organic solvents like DMF and DMSO but is poorly soluble in water. Chemically, it is stable under normal conditions but can react with strong bases to form the corresponding anion. The compound exhibits low reactivity with most common reagents, ensuring safety in laboratory settings.

About

English Name N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (1:1)
Molecular Formula C16H19ClN2O5S
Molecular Weight 386.86 g/mol
SMILES COC1=CC(=C(C=C1C(=O)CN)OC2=CC=CC=C2)NS(=O)(=O)C.Cl
InChIKey NWUBXODWWYGUHS-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9) typically synthesized?

N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride is typically synthesized via ...

Compound Q&A

What industries use N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9)?

N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride (CAS: 149436-41-9)?

When handling N-(4-Glycyl-5-methoxy-2-phenoxyphenyl)methanesulfonamide hydrochloride, it is crucial ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...