Compound Q&A

What precautions should be taken when handling Rupatadine (CAS: 158876-82-5)?

Answer

Rupatadine
When handling Rupatadine, it is essential to use personal protective equipment (PPE) such as gloves and goggles. It should be stored in a cool, dry place away from direct sunlight. Spills should be cleaned up with caution, and the Material Safety Data Sheet (MSDS) or Safety Data Sheet (SDS) should be consulted for specific procedures. Fume hoods should be used during its handling to minimize inhalation risks.

About

English Name Rupatadine
Molecular Formula C26H26ClN3
Molecular Weight 415.96800000000025 g/mol
SMILES CC1=CC(=CN=C1)CN2CCC(=C3C4=C(CCC5=C3N=CC=C5)C=C(C=C4)Cl)CC2
InChIKey WUZYKBABMWJHDL-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rupatadine (CAS: 158876-82-5)?

Rupatadine is a white to off-white crystalline compound. Its molecular weight is approximately 325.3...

Compound Q&A

How is Rupatadine (CAS: 158876-82-5) typically synthesized?

Rupatadine is synthesized via a multi-step process, starting with the synthesis of the key intermedi...

Compound Q&A

What industries use Rupatadine (CAS: 158876-82-5)?

Rupatadine is primarily used in the pharmaceutical industry for the treatment of allergic rhinitis a...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...