Compound Q&A

What industries use Rupatadine (CAS: 158876-82-5)?

Answer

Rupatadine is primarily used in the pharmaceutical industry for the treatment of allergic rhinitis and pruritus. It is also explored in the cosmetics industry for its anti-itching properties. Additionally, due to its chemical structure, it may have potential applications in other sectors such as drug delivery systems and topical treatments.

About

CAS No 158876-82-5

English Name Rupatadine

Molecular Formula C26H26ClN3

Molecular Weight 415.96800000000025 g/mol

SMILES CC1=CC(=CN=C1)CN2CCC(=C3C4=C(CCC5=C3N=CC=C5)C=C(C=C4)Cl)CC2

InChIKey WUZYKBABMWJHDL-UHFFFAOYSA-N

Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rupatadine (CAS: 158876-82-5)?

Rupatadine is a white to off-white crystalline compound. Its molecular weight is approximately 325.3...

Compound Q&A

How is Rupatadine (CAS: 158876-82-5) typically synthesized?

Rupatadine is synthesized via a multi-step process, starting with the synthesis of the key intermedi...

Compound Q&A

What precautions should be taken when handling Rupatadine (CAS: 158876-82-5)?

When handling Rupatadine, it is essential to use personal protective equipment (PPE) such as gloves ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What industries use Rupatadine (CAS: 158876-82-5)?

Answer

About

Related Q&A

What are the physical and chemical properties of Rupatadine (CAS: 158876-82-5)?

How is Rupatadine (CAS: 158876-82-5) typically synthesized?

What precautions should be taken when handling Rupatadine (CAS: 158876-82-5)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

HuBeiMoDe Chemical Co Ltd

HuBeiXinGongLi Chemical Co Ltd

ShenZhenZhenJiangShengWuJiShu Co Ltd

Hubei Yangxin Pharmaceutical Technology Co., Ltd.

ShenZhenShiHengFengMoDa Chemical Co Ltd

Beijing Huafenglianbo Technology Co., Ltd.